C19H21NS2 — CID 172742944
N,N-dimethyl-3-(2-methylsulfanylthioxanthen-9-ylidene)propan-1-amine (PubChem CID 172742944) has the molecular formula C19H21NS2 and a molecular weight of 327.52 g/mol. Its IUPAC name is N,N-dimethyl-3-(2-methylsulfanylthioxanthen-9-ylidene)propan-1-amine.
| Compound Name | N,N-dimethyl-3-(2-methylsulfanylthioxanthen-9-ylidene)propan-1-amine |
|---|---|
| PubChem CID | 172742944 |
| Molecular Formula | C19H21NS2 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N,N-dimethyl-3-(2-methylsulfanylthioxanthen-9-ylidene)propan-1-amine |
| SMILES | CSc1ccc2c(c1)C(=CCCN(C)C)c1ccccc1S2 |
| InChI | InChI=1S/C19H21NS2/c1-20(2)12-6-8-15-16-7-4-5-9-18(16)22-19-11-10-14(21-3)13-17(15)19/h4-5,7-11,13H,6,12H2,1-3H3 |
| InChIKey | JILNOUKPSAMOGZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|