C18H19Cl2NS — CID 131707614
3-(2-chlorothioxanthen-9-ylidene)-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride (PubChem CID 131707614) has the molecular formula C18H19Cl2NS and a molecular weight of 358.37 g/mol. Its IUPAC name is 3-(2-chlorothioxanthen-9-ylidene)-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride.
| Compound Name | 3-(2-chlorothioxanthen-9-ylidene)-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 131707614 |
| Molecular Formula | C18H19Cl2NS |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 3-(2-chlorothioxanthen-9-ylidene)-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])N(CCC=C1c2ccccc2Sc2ccc(Cl)cc21)C([2H])([2H])[2H] |
| InChI | InChI=1S/C18H18ClNS.ClH/c1-20(2)11-5-7-14-15-6-3-4-8-17(15)21-18-10-9-13(19)12-16(14)18;/h3-4,6-10,12H,5,11H2,1-2H3;1H/i1D3,2D3; |
| InChIKey | YWKRLOSRDGPEJR-TXHXQZCNSA-N |
| XLogP | 5.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|