C21H26ClN — CID 172653286
3-(10,10-dimethylanthracen-9-ylidene)-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride (PubChem CID 172653286) has the molecular formula C21H26ClN and a molecular weight of 333.94 g/mol. Its IUPAC name is 3-(10,10-dimethylanthracen-9-ylidene)-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride.
| Compound Name | 3-(10,10-dimethylanthracen-9-ylidene)-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 172653286 |
| Molecular Formula | C21H26ClN |
| Molecular Weight | 333.94 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 3-(10,10-dimethylanthracen-9-ylidene)-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])N(CCC=C1c2ccccc2C(C)(C)c2ccccc21)C([2H])([2H])[2H] |
| InChI | InChI=1S/C21H25N.ClH/c1-21(2)19-13-7-5-10-17(19)16(12-9-15-22(3)4)18-11-6-8-14-20(18)21;/h5-8,10-14H,9,15H2,1-4H3;1H/i3D3,4D3; |
| InChIKey | RADLXCPDUXFGFF-SKCUOGQWSA-N |
| XLogP | 5.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.94 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|