C21H24ClN — CID 6068334
(3Z)-3-(2-chloro-10,10-dimethylanthracen-9-ylidene)-N,N-dimethylpropan-1-amine (PubChem CID 6068334) has the molecular formula C21H24ClN and a molecular weight of 325.88 g/mol. Its IUPAC name is (3Z)-3-(2-chloro-10,10-dimethylanthracen-9-ylidene)-N,N-dimethylpropan-1-amine.
| Compound Name | (3Z)-3-(2-chloro-10,10-dimethylanthracen-9-ylidene)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 6068334 |
| Molecular Formula | C21H24ClN |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (3Z)-3-(2-chloro-10,10-dimethylanthracen-9-ylidene)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CC/C=C1/c2ccccc2C(C)(C)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H24ClN/c1-21(2)19-10-6-5-8-17(19)16(9-7-13-23(3)4)18-14-15(22)11-12-20(18)21/h5-6,8-12,14H,7,13H2,1-4H3/b16-9- |
| InChIKey | XOEORRKMZPENHA-SXGWCWSVSA-N |
| XLogP | 5.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|