C18H17Cl2FNS- — CID 53351519
(3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine chloride (PubChem CID 53351519) has the molecular formula C18H17Cl2FNS- and a molecular weight of 369.31 g/mol. Its IUPAC name is (3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine chloride.
| Compound Name | (3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine chloride |
|---|---|
| PubChem CID | 53351519 |
| Molecular Formula | C18H17Cl2FNS- |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | (3Z)-3-(2-chloro-6-fluorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine chloride |
| SMILES | CN(C)CC/C=C1/c2ccc(F)cc2Sc2ccc(Cl)cc21.[Cl-] |
| InChI | InChI=1S/C18H17ClFNS.ClH/c1-21(2)9-3-4-14-15-7-6-13(20)11-18(15)22-17-8-5-12(19)10-16(14)17;/h4-8,10-11H,3,9H2,1-2H3;1H/p-1/b14-4-; |
| InChIKey | OSDYYIHCOCODMF-CYBPKNTASA-M |
| XLogP | 2.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|