C22H22ClNO5S — CID 50990471
(E)-but-2-enedioic acid;(9Z)-7-chloro-9-[3-(dimethylamino)propylidene]thioxanthen-2-ol (PubChem CID 50990471) has the molecular formula C22H22ClNO5S and a molecular weight of 447.94 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(9Z)-7-chloro-9-[3-(dimethylamino)propylidene]thioxanthen-2-ol.
| Compound Name | (E)-but-2-enedioic acid;(9Z)-7-chloro-9-[3-(dimethylamino)propylidene]thioxanthen-2-ol |
|---|---|
| PubChem CID | 50990471 |
| Molecular Formula | C22H22ClNO5S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | (E)-but-2-enedioic acid;(9Z)-7-chloro-9-[3-(dimethylamino)propylidene]thioxanthen-2-ol |
| SMILES | CN(C)CC/C=C1/c2cc(O)ccc2Sc2ccc(Cl)cc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H18ClNOS.C4H4O4/c1-20(2)9-3-4-14-15-10-12(19)5-7-17(15)22-18-8-6-13(21)11-16(14)18;5-3(6)1-2-4(7)8/h4-8,10-11,21H,3,9H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b14-4+;2-1+ |
| InChIKey | RGDNFMIFGYFUMC-LHKCSRJASA-N |
| XLogP | 4.61 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|