C25H28FNO4S — CID 6446976
(E)-but-2-enedioic acid;(3E)-3-(6-fluoro-2-propan-2-ylthioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine (PubChem CID 6446976) has the molecular formula C25H28FNO4S and a molecular weight of 457.57 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(3E)-3-(6-fluoro-2-propan-2-ylthioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine.
| Compound Name | (E)-but-2-enedioic acid;(3E)-3-(6-fluoro-2-propan-2-ylthioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 6446976 |
| Molecular Formula | C25H28FNO4S |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (E)-but-2-enedioic acid;(3E)-3-(6-fluoro-2-propan-2-ylthioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine |
| SMILES | CC(C)c1ccc2c(c1)/C(=C/CCN(C)C)c1ccc(F)cc1S2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H24FNS.C4H4O4/c1-14(2)15-7-10-20-19(12-15)17(6-5-11-23(3)4)18-9-8-16(22)13-21(18)24-20;5-3(6)1-2-4(7)8/h6-10,12-14H,5,11H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b17-6+;2-1+ |
| InChIKey | ANSVQKDQEBVIKN-YSNUBWRRSA-N |
| XLogP | 5.51 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|