C21H25NS — CID 6444709
(3E)-N,N-dimethyl-3-(2-propan-2-ylthioxanthen-9-ylidene)propan-1-amine (PubChem CID 6444709) has the molecular formula C21H25NS and a molecular weight of 323.50 g/mol. Its IUPAC name is (3E)-N,N-dimethyl-3-(2-propan-2-ylthioxanthen-9-ylidene)propan-1-amine.
| Compound Name | (3E)-N,N-dimethyl-3-(2-propan-2-ylthioxanthen-9-ylidene)propan-1-amine |
|---|---|
| PubChem CID | 6444709 |
| Molecular Formula | C21H25NS |
| Molecular Weight | 323.50 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (3E)-N,N-dimethyl-3-(2-propan-2-ylthioxanthen-9-ylidene)propan-1-amine |
| SMILES | CC(C)c1ccc2c(c1)/C(=C/CCN(C)C)c1ccccc1S2 |
| InChI | InChI=1S/C21H25NS/c1-15(2)16-11-12-21-19(14-16)17(9-7-13-22(3)4)18-8-5-6-10-20(18)23-21/h5-6,8-12,14-15H,7,13H2,1-4H3/b17-9+ |
| InChIKey | QYQRZUFCHQJONE-RQZCQDPDSA-N |
| XLogP | 5.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|