C20H25ClN2O2S2 — CID 6445244
(9E)-9-[3-(dimethylamino)propylidene]-N,N-dimethylthioxanthene-2-sulfonamide;hydrochloride (PubChem CID 6445244) has the molecular formula C20H25ClN2O2S2 and a molecular weight of 425.02 g/mol. Its IUPAC name is (9E)-9-[3-(dimethylamino)propylidene]-N,N-dimethylthioxanthene-2-sulfonamide;hydrochloride.
| Compound Name | (9E)-9-[3-(dimethylamino)propylidene]-N,N-dimethylthioxanthene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 6445244 |
| Molecular Formula | C20H25ClN2O2S2 |
| Molecular Weight | 425.02 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | (9E)-9-[3-(dimethylamino)propylidene]-N,N-dimethylthioxanthene-2-sulfonamide;hydrochloride |
| SMILES | CN(C)CC/C=C1\c2ccccc2Sc2ccc(S(=O)(=O)N(C)C)cc21.Cl |
| InChI | InChI=1S/C20H24N2O2S2.ClH/c1-21(2)13-7-9-16-17-8-5-6-10-19(17)25-20-12-11-15(14-18(16)20)26(23,24)22(3)4;/h5-6,8-12,14H,7,13H2,1-4H3;1H/b16-9+; |
| InChIKey | ORNIKDGQXMSJPY-QOVZSLTQSA-N |
| XLogP | 4.21 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.02 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|