C19H23N3O3S2 — CID 142888728
10-[3-(dimethylamino)propanoyl]-N,N-dimethylphenothiazine-2-sulfonamide (PubChem CID 142888728) has the molecular formula C19H23N3O3S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is 10-[3-(dimethylamino)propanoyl]-N,N-dimethylphenothiazine-2-sulfonamide.
| Compound Name | 10-[3-(dimethylamino)propanoyl]-N,N-dimethylphenothiazine-2-sulfonamide |
|---|---|
| PubChem CID | 142888728 |
| Molecular Formula | C19H23N3O3S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 10-[3-(dimethylamino)propanoyl]-N,N-dimethylphenothiazine-2-sulfonamide |
| SMILES | CN(C)CCC(=O)N1c2ccccc2Sc2ccc(S(=O)(=O)N(C)C)cc21 |
| InChI | InChI=1S/C19H23N3O3S2/c1-20(2)12-11-19(23)22-15-7-5-6-8-17(15)26-18-10-9-14(13-16(18)22)27(24,25)21(3)4/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | XGDKXXUQIGHHGD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |