C23H21ClN2O3S2 — CID 1036851
4-chloro-N,N-diethyl-3-(phenothiazine-10-carbonyl)benzenesulfonamide (PubChem CID 1036851) has the molecular formula C23H21ClN2O3S2 and a molecular weight of 473.02 g/mol. Its IUPAC name is 4-chloro-N,N-diethyl-3-(phenothiazine-10-carbonyl)benzenesulfonamide.
| Compound Name | 4-chloro-N,N-diethyl-3-(phenothiazine-10-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 1036851 |
| Molecular Formula | C23H21ClN2O3S2 |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 4-chloro-N,N-diethyl-3-(phenothiazine-10-carbonyl)benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)N2c3ccccc3Sc3ccccc32)c1 |
| InChI | InChI=1S/C23H21ClN2O3S2/c1-3-25(4-2)31(28,29)16-13-14-18(24)17(15-16)23(27)26-19-9-5-7-11-21(19)30-22-12-8-6-10-20(22)26/h5-15H,3-4H2,1-2H3 |
| InChIKey | QOLQVBLBYFMDTL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |