C23H29N3O3S2 — CID 147517946
(9E)-9-[1-hydroxy-3-(4-methylpiperazin-1-yl)propylidene]-N,N-dimethylthioxanthene-2-sulfonamide (PubChem CID 147517946) has the molecular formula C23H29N3O3S2 and a molecular weight of 459.64 g/mol. Its IUPAC name is (9E)-9-[1-hydroxy-3-(4-methylpiperazin-1-yl)propylidene]-N,N-dimethylthioxanthene-2-sulfonamide.
| Compound Name | (9E)-9-[1-hydroxy-3-(4-methylpiperazin-1-yl)propylidene]-N,N-dimethylthioxanthene-2-sulfonamide |
|---|---|
| PubChem CID | 147517946 |
| Molecular Formula | C23H29N3O3S2 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (9E)-9-[1-hydroxy-3-(4-methylpiperazin-1-yl)propylidene]-N,N-dimethylthioxanthene-2-sulfonamide |
| SMILES | CN1CCN(CC/C(O)=C2/c3ccccc3Sc3ccc(S(=O)(=O)N(C)C)cc32)CC1 |
| InChI | InChI=1S/C23H29N3O3S2/c1-24(2)31(28,29)17-8-9-22-19(16-17)23(18-6-4-5-7-21(18)30-22)20(27)10-11-26-14-12-25(3)13-15-26/h4-9,16,27H,10-15H2,1-3H3/b23-20+ |
| InChIKey | FKPAUHORMSFYOK-BSYVCWPDSA-N |
| XLogP | 3.36 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|