C24H31N3O3S2 — CID 6445192
(9E)-9-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propylidene]-N,N-dimethylthioxanthene-2-sulfonamide (PubChem CID 6445192) has the molecular formula C24H31N3O3S2 and a molecular weight of 473.66 g/mol. Its IUPAC name is (9E)-9-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propylidene]-N,N-dimethylthioxanthene-2-sulfonamide.
| Compound Name | (9E)-9-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propylidene]-N,N-dimethylthioxanthene-2-sulfonamide |
|---|---|
| PubChem CID | 6445192 |
| Molecular Formula | C24H31N3O3S2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | (9E)-9-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propylidene]-N,N-dimethylthioxanthene-2-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)/C(=C/CCN1CCN(CCO)CC1)c1ccccc1S2 |
| InChI | InChI=1S/C24H31N3O3S2/c1-25(2)32(29,30)19-9-10-24-22(18-19)20(21-6-3-4-8-23(21)31-24)7-5-11-26-12-14-27(15-13-26)16-17-28/h3-4,6-10,18,28H,5,11-17H2,1-2H3/b20-7+ |
| InChIKey | KBAIWEWSBMTDBF-IFRROFPPSA-N |
| XLogP | 2.83 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|