C22H25IN2OS — CID 20839001
2-[4-[(3E)-3-(2-iodothioxanthen-9-ylidene)propyl]piperazin-1-yl]ethanol (PubChem CID 20839001) has the molecular formula C22H25IN2OS and a molecular weight of 492.43 g/mol. Its IUPAC name is 2-[4-[(3E)-3-(2-iodothioxanthen-9-ylidene)propyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[(3E)-3-(2-iodothioxanthen-9-ylidene)propyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 20839001 |
| Molecular Formula | C22H25IN2OS |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 2-[4-[(3E)-3-(2-iodothioxanthen-9-ylidene)propyl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(CC/C=C2\c3ccccc3Sc3ccc(I)cc32)CC1 |
| InChI | InChI=1S/C22H25IN2OS/c23-17-7-8-22-20(16-17)18(19-4-1-2-6-21(19)27-22)5-3-9-24-10-12-25(13-11-24)14-15-26/h1-2,4-8,16,26H,3,9-15H2/b18-5+ |
| InChIKey | MJZOTDKWZDOBCS-BLLMUTORSA-N |
| XLogP | 4.19 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|