C30H31Cl2F3N2O3S — CID 69286362
4-chlorobenzoic acid;2-[4-[(3Z)-3-[2-(trifluoromethyl)thioxanthen-9-ylidene]propyl]piperazin-1-yl]ethanol;hydrochloride (PubChem CID 69286362) has the molecular formula C30H31Cl2F3N2O3S and a molecular weight of 627.56 g/mol. Its IUPAC name is 4-chlorobenzoic acid;2-[4-[(3Z)-3-[2-(trifluoromethyl)thioxanthen-9-ylidene]propyl]piperazin-1-yl]ethanol;hydrochloride.
| Compound Name | 4-chlorobenzoic acid;2-[4-[(3Z)-3-[2-(trifluoromethyl)thioxanthen-9-ylidene]propyl]piperazin-1-yl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 69286362 |
| Molecular Formula | C30H31Cl2F3N2O3S |
| Molecular Weight | 627.56 g/mol |
| Exact Mass | 626.14 |
| IUPAC Name | 4-chlorobenzoic acid;2-[4-[(3Z)-3-[2-(trifluoromethyl)thioxanthen-9-ylidene]propyl]piperazin-1-yl]ethanol;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(Cl)cc1.OCCN1CCN(CC/C=C2/c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C23H25F3N2OS.C7H5ClO2.ClH/c24-23(25,26)17-7-8-22-20(16-17)18(19-4-1-2-6-21(19)30-22)5-3-9-27-10-12-28(13-11-27)14-15-29;8-6-3-1-5(2-4-6)7(9)10;/h1-2,4-8,16,29H,3,9-15H2;1-4H,(H,9,10);1H/b18-5-;; |
| InChIKey | MKGSNWRXTPHUNJ-MHKBYHAFSA-N |
| XLogP | 7.06 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.56 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|