C24H29Cl3N2O2S — CID 6446672
methyl 3-[4-[(3E)-3-(2-chlorothioxanthen-9-ylidene)propyl]piperazin-1-yl]propanoate;dihydrochloride (PubChem CID 6446672) has the molecular formula C24H29Cl3N2O2S and a molecular weight of 515.93 g/mol. Its IUPAC name is methyl 3-[4-[(3E)-3-(2-chlorothioxanthen-9-ylidene)propyl]piperazin-1-yl]propanoate;dihydrochloride.
| Compound Name | methyl 3-[4-[(3E)-3-(2-chlorothioxanthen-9-ylidene)propyl]piperazin-1-yl]propanoate;dihydrochloride |
|---|---|
| PubChem CID | 6446672 |
| Molecular Formula | C24H29Cl3N2O2S |
| Molecular Weight | 515.93 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | methyl 3-[4-[(3E)-3-(2-chlorothioxanthen-9-ylidene)propyl]piperazin-1-yl]propanoate;dihydrochloride |
| SMILES | COC(=O)CCN1CCN(CC/C=C2\c3ccccc3Sc3ccc(Cl)cc32)CC1.Cl.Cl |
| InChI | InChI=1S/C24H27ClN2O2S.2ClH/c1-29-24(28)10-12-27-15-13-26(14-16-27)11-4-6-19-20-5-2-3-7-22(20)30-23-9-8-18(25)17-21(19)23;;/h2-3,5-9,17H,4,10-16H2,1H3;2*1H/b19-6+;; |
| InChIKey | CFAPPJQXJQUYNZ-AUUXLREUSA-N |
| XLogP | 5.65 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.93 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|