C23H28N2OS — CID 157309570
2-[4-[(3Z)-3-(2-methylthioxanthen-9-ylidene)propyl]piperazin-1-yl]ethanol (PubChem CID 157309570) has the molecular formula C23H28N2OS and a molecular weight of 380.56 g/mol. Its IUPAC name is 2-[4-[(3Z)-3-(2-methylthioxanthen-9-ylidene)propyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[(3Z)-3-(2-methylthioxanthen-9-ylidene)propyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 157309570 |
| Molecular Formula | C23H28N2OS |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 2-[4-[(3Z)-3-(2-methylthioxanthen-9-ylidene)propyl]piperazin-1-yl]ethanol |
| SMILES | Cc1ccc2c(c1)/C(=C\CCN1CCN(CCO)CC1)c1ccccc1S2 |
| InChI | InChI=1S/C23H28N2OS/c1-18-8-9-23-21(17-18)19(20-5-2-3-7-22(20)27-23)6-4-10-24-11-13-25(14-12-24)15-16-26/h2-3,5-9,17,26H,4,10-16H2,1H3/b19-6- |
| InChIKey | BCWNYXJFGRPZAB-SWNXQHNESA-N |
| XLogP | 3.89 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|