C23H24BrF3N2S — CID 5053540
1-(2-bromoethyl)-4-[3-[2-(trifluoromethyl)thioxanthen-9-ylidene]propyl]piperazine (PubChem CID 5053540) has the molecular formula C23H24BrF3N2S and a molecular weight of 497.42 g/mol. Its IUPAC name is 1-(2-bromoethyl)-4-[3-[2-(trifluoromethyl)thioxanthen-9-ylidene]propyl]piperazine.
| Compound Name | 1-(2-bromoethyl)-4-[3-[2-(trifluoromethyl)thioxanthen-9-ylidene]propyl]piperazine |
|---|---|
| PubChem CID | 5053540 |
| Molecular Formula | C23H24BrF3N2S |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 1-(2-bromoethyl)-4-[3-[2-(trifluoromethyl)thioxanthen-9-ylidene]propyl]piperazine |
| SMILES | FC(F)(F)c1ccc2c(c1)C(=CCCN1CCN(CCBr)CC1)c1ccccc1S2 |
| InChI | InChI=1S/C23H24BrF3N2S/c24-9-11-29-14-12-28(13-15-29)10-3-5-18-19-4-1-2-6-21(19)30-22-8-7-17(16-20(18)22)23(25,26)27/h1-2,4-8,16H,3,9-15H2 |
| InChIKey | MJXDOOJJFLVYCF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|