C21H25N — CID 77390822
N,N-dimethyl-3-(9-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propan-1-amine (PubChem CID 77390822) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is N,N-dimethyl-3-(9-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propan-1-amine.
| Compound Name | N,N-dimethyl-3-(9-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propan-1-amine |
|---|---|
| PubChem CID | 77390822 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | N,N-dimethyl-3-(9-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propan-1-amine |
| SMILES | CC1Cc2ccccc2C(=CCCN(C)C)c2ccccc21 |
| InChI | InChI=1S/C21H25N/c1-16-15-17-9-4-5-11-19(17)21(13-8-14-22(2)3)20-12-7-6-10-18(16)20/h4-7,9-13,16H,8,14-15H2,1-3H3 |
| InChIKey | CJBAYNLKTGGVDH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|