C22H27N — CID 67976858
(3E)-3-(9-ethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)-N,N-dimethylpropan-1-amine (PubChem CID 67976858) has the molecular formula C22H27N and a molecular weight of 305.47 g/mol. Its IUPAC name is (3E)-3-(9-ethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)-N,N-dimethylpropan-1-amine.
| Compound Name | (3E)-3-(9-ethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 67976858 |
| Molecular Formula | C22H27N |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | (3E)-3-(9-ethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)-N,N-dimethylpropan-1-amine |
| SMILES | CCC1Cc2ccccc2/C(=C\CCN(C)C)c2ccccc21 |
| InChI | InChI=1S/C22H27N/c1-4-17-16-18-10-5-6-12-20(18)22(14-9-15-23(2)3)21-13-8-7-11-19(17)21/h5-8,10-14,17H,4,9,15-16H2,1-3H3/b22-14+ |
| InChIKey | GWLJMSJHDUIEOM-HYARGMPZSA-N |
| XLogP | 5.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|