C19H21NSe — CID 6857911
(3Z)-3-(6H-benzo[c][1]benzoselenepin-11-ylidene)-N,N-dimethylpropan-1-amine (PubChem CID 6857911) has the molecular formula C19H21NSe and a molecular weight of 342.34 g/mol. Its IUPAC name is (3Z)-3-(6H-benzo[c][1]benzoselenepin-11-ylidene)-N,N-dimethylpropan-1-amine.
| Compound Name | (3Z)-3-(6H-benzo[c][1]benzoselenepin-11-ylidene)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 6857911 |
| Molecular Formula | C19H21NSe |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | (3Z)-3-(6H-benzo[c][1]benzoselenepin-11-ylidene)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CC/C=C1/c2ccccc2C[Se]c2ccccc21 |
| InChI | InChI=1S/C19H21NSe/c1-20(2)13-7-11-17-16-9-4-3-8-15(16)14-21-19-12-6-5-10-18(17)19/h3-6,8-12H,7,13-14H2,1-2H3/b17-11- |
| InChIKey | FRLYHPYPKTXYQN-BOPFTXTBSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|