C18H17BrO — CID 67960249
(9S)-2-(3-bromopropylidene)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-ol (PubChem CID 67960249) has the molecular formula C18H17BrO and a molecular weight of 329.24 g/mol. Its IUPAC name is (9S)-2-(3-bromopropylidene)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-ol.
| Compound Name | (9S)-2-(3-bromopropylidene)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-ol |
|---|---|
| PubChem CID | 67960249 |
| Molecular Formula | C18H17BrO |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | (9S)-2-(3-bromopropylidene)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-9-ol |
| SMILES | O[C@H]1Cc2ccccc2C(=CCCBr)c2ccccc21 |
| InChI | InChI=1S/C18H17BrO/c19-11-5-10-15-14-7-2-1-6-13(14)12-18(20)17-9-4-3-8-16(15)17/h1-4,6-10,18,20H,5,11-12H2/t18-/m0/s1 |
| InChIKey | KNGHLHQCMDBTQE-SFHVURJKSA-N |
| XLogP | 4.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|