C23H29ClNS+ — CID 155234295
3-(2-chlorothioxanthen-9-ylidene)propyl-dimethyl-(3-methylbutyl)azanium (PubChem CID 155234295) has the molecular formula C23H29ClNS+ and a molecular weight of 387.01 g/mol. Its IUPAC name is 3-(2-chlorothioxanthen-9-ylidene)propyl-dimethyl-(3-methylbutyl)azanium.
| Compound Name | 3-(2-chlorothioxanthen-9-ylidene)propyl-dimethyl-(3-methylbutyl)azanium |
|---|---|
| PubChem CID | 155234295 |
| Molecular Formula | C23H29ClNS+ |
| Molecular Weight | 387.01 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 3-(2-chlorothioxanthen-9-ylidene)propyl-dimethyl-(3-methylbutyl)azanium |
| SMILES | CC(C)CC[N+](C)(C)CCC=C1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C23H29ClNS/c1-17(2)13-15-25(3,4)14-7-9-19-20-8-5-6-10-22(20)26-23-12-11-18(24)16-21(19)23/h5-6,8-12,16-17H,7,13-15H2,1-4H3/q+1 |
| InChIKey | VRAJHRARVOWXOV-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.01 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|