C14H24FNO — CID 143806677
(4E,6E)-N-fluoro-7-methoxy-6-(2-methylprop-1-enyl)nona-4,6-dien-1-amine (PubChem CID 143806677) has the molecular formula C14H24FNO and a molecular weight of 241.35 g/mol. Its IUPAC name is (4E,6E)-N-fluoro-7-methoxy-6-(2-methylprop-1-enyl)nona-4,6-dien-1-amine.
| Compound Name | (4E,6E)-N-fluoro-7-methoxy-6-(2-methylprop-1-enyl)nona-4,6-dien-1-amine |
|---|---|
| PubChem CID | 143806677 |
| Molecular Formula | C14H24FNO |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (4E,6E)-N-fluoro-7-methoxy-6-(2-methylprop-1-enyl)nona-4,6-dien-1-amine |
| SMILES | CC/C(OC)=C(C=C(C)C)/C=C/CCCNF |
| InChI | InChI=1S/C14H24FNO/c1-5-14(17-4)13(11-12(2)3)9-7-6-8-10-16-15/h7,9,11,16H,5-6,8,10H2,1-4H3/b9-7+,14-13+ |
| InChIKey | YLMKLECVLLBGPM-ZEOGUJRDSA-N |
| XLogP | 4.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|