C16H30FNO — CID 143806676
ethane;(4E,6E)-N-fluoro-7-methoxy-6-(2-methylprop-1-enyl)nona-4,6-dien-1-amine (PubChem CID 143806676) has the molecular formula C16H30FNO and a molecular weight of 271.42 g/mol. Its IUPAC name is ethane;(4E,6E)-N-fluoro-7-methoxy-6-(2-methylprop-1-enyl)nona-4,6-dien-1-amine.
| Compound Name | ethane;(4E,6E)-N-fluoro-7-methoxy-6-(2-methylprop-1-enyl)nona-4,6-dien-1-amine |
|---|---|
| PubChem CID | 143806676 |
| Molecular Formula | C16H30FNO |
| Molecular Weight | 271.42 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | ethane;(4E,6E)-N-fluoro-7-methoxy-6-(2-methylprop-1-enyl)nona-4,6-dien-1-amine |
| SMILES | CC.CC/C(OC)=C(C=C(C)C)/C=C/CCCNF |
| InChI | InChI=1S/C14H24FNO.C2H6/c1-5-14(17-4)13(11-12(2)3)9-7-6-8-10-16-15;1-2/h7,9,11,16H,5-6,8,10H2,1-4H3;1-2H3/b9-7+,14-13+; |
| InChIKey | JAXJBTFOQWVYMF-MZMQDADASA-N |
| XLogP | 5.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|