C17H23NO — CID 143161653
[4-[(2Z,4Z)-2-ethoxyhepta-2,4,6-trien-3-yl]cyclohepta-1,3,5-trien-1-yl]methanamine (PubChem CID 143161653) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is [4-[(2Z,4Z)-2-ethoxyhepta-2,4,6-trien-3-yl]cyclohepta-1,3,5-trien-1-yl]methanamine.
| Compound Name | [4-[(2Z,4Z)-2-ethoxyhepta-2,4,6-trien-3-yl]cyclohepta-1,3,5-trien-1-yl]methanamine |
|---|---|
| PubChem CID | 143161653 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | [4-[(2Z,4Z)-2-ethoxyhepta-2,4,6-trien-3-yl]cyclohepta-1,3,5-trien-1-yl]methanamine |
| SMILES | C=C/C=C\C(C1=CC=C(CN)CC=C1)=C(/C)OCC |
| InChI | InChI=1S/C17H23NO/c1-4-6-10-17(14(3)19-5-2)16-9-7-8-15(13-18)11-12-16/h4,6-7,9-12H,1,5,8,13,18H2,2-3H3/b10-6-,17-14- |
| InChIKey | ZONZVKYKTJYAKU-MDMJWOLCSA-N |
| XLogP | 3.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|