C16H32FNO — CID 153364880
butan-1-amine;ethane;(3Z,5Z)-4-(fluoromethyl)-3-methoxyocta-1,3,5-triene (PubChem CID 153364880) has the molecular formula C16H32FNO and a molecular weight of 273.44 g/mol. Its IUPAC name is butan-1-amine;ethane;(3Z,5Z)-4-(fluoromethyl)-3-methoxyocta-1,3,5-triene.
| Compound Name | butan-1-amine;ethane;(3Z,5Z)-4-(fluoromethyl)-3-methoxyocta-1,3,5-triene |
|---|---|
| PubChem CID | 153364880 |
| Molecular Formula | C16H32FNO |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | butan-1-amine;ethane;(3Z,5Z)-4-(fluoromethyl)-3-methoxyocta-1,3,5-triene |
| SMILES | C=C/C(OC)=C(\C=C/CC)CF.CC.CCCCN |
| InChI | InChI=1S/C10H15FO.C4H11N.C2H6/c1-4-6-7-9(8-11)10(5-2)12-3;1-2-3-4-5;1-2/h5-7H,2,4,8H2,1,3H3;2-5H2,1H3;1-2H3/b7-6-,10-9-;; |
| InChIKey | ODNUZICDDXZRCC-JFHYDWJLSA-N |
| XLogP | 4.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|