C19H34O2 — CID 143806742
ethane;1-[(E)-8-ethoxyoct-2-enoxy]-4-methylcyclohexa-1,3-diene (PubChem CID 143806742) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is ethane;1-[(E)-8-ethoxyoct-2-enoxy]-4-methylcyclohexa-1,3-diene.
| Compound Name | ethane;1-[(E)-8-ethoxyoct-2-enoxy]-4-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143806742 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | ethane;1-[(E)-8-ethoxyoct-2-enoxy]-4-methylcyclohexa-1,3-diene |
| SMILES | CC.CCOCCCCC/C=C/COC1=CC=C(C)CC1 |
| InChI | InChI=1S/C17H28O2.C2H6/c1-3-18-14-8-6-4-5-7-9-15-19-17-12-10-16(2)11-13-17;1-2/h7,9-10,12H,3-6,8,11,13-15H2,1-2H3;1-2H3/b9-7+; |
| InChIKey | VAEOYINGIHICAF-BXTVWIJMSA-N |
| XLogP | 5.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|