C15H28O — CID 143806870
ethane;(3E,4Z)-4-prop-2-enylidene-3-propylideneoxane (PubChem CID 143806870) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is ethane;(3E,4Z)-4-prop-2-enylidene-3-propylideneoxane.
| Compound Name | ethane;(3E,4Z)-4-prop-2-enylidene-3-propylideneoxane |
|---|---|
| PubChem CID | 143806870 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | ethane;(3E,4Z)-4-prop-2-enylidene-3-propylideneoxane |
| SMILES | C=C/C=C1/CCOC/C1=C/CC.CC.CC |
| InChI | InChI=1S/C11H16O.2C2H6/c1-3-5-10-7-8-12-9-11(10)6-4-2;2*1-2/h3,5-6H,1,4,7-9H2,2H3;2*1-2H3/b10-5-,11-6-;; |
| InChIKey | GPXJNQBTOGKQQB-RNUXQIGMSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |