C12H16N2O — CID 143807041
ethane;7-methyl-4,8-dihydrocyclohepta[b]pyrazin-3-one (PubChem CID 143807041) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is ethane;7-methyl-4,8-dihydrocyclohepta[b]pyrazin-3-one.
| Compound Name | ethane;7-methyl-4,8-dihydrocyclohepta[b]pyrazin-3-one |
|---|---|
| PubChem CID | 143807041 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | ethane;7-methyl-4,8-dihydrocyclohepta[b]pyrazin-3-one |
| SMILES | CC.CC1=CC=c2[nH]c(=O)cnc2=CC1 |
| InChI | InChI=1S/C10H10N2O.C2H6/c1-7-2-4-8-9(5-3-7)12-10(13)6-11-8;1-2/h3-6H,2H2,1H3,(H,12,13);1-2H3 |
| InChIKey | WDTXTKSUVHWJSH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |