C19H16Cl2N2O3S — CID 143812316
3-[3-[[5-(3,5-dichlorophenyl)-5-methyl-4-oxo-2-sulfanylidene-1,3-oxazolidin-3-yl]amino]phenyl]propanal (PubChem CID 143812316) has the molecular formula C19H16Cl2N2O3S and a molecular weight of 423.32 g/mol. Its IUPAC name is 3-[3-[[5-(3,5-dichlorophenyl)-5-methyl-4-oxo-2-sulfanylidene-1,3-oxazolidin-3-yl]amino]phenyl]propanal.
| Compound Name | 3-[3-[[5-(3,5-dichlorophenyl)-5-methyl-4-oxo-2-sulfanylidene-1,3-oxazolidin-3-yl]amino]phenyl]propanal |
|---|---|
| PubChem CID | 143812316 |
| Molecular Formula | C19H16Cl2N2O3S |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 3-[3-[[5-(3,5-dichlorophenyl)-5-methyl-4-oxo-2-sulfanylidene-1,3-oxazolidin-3-yl]amino]phenyl]propanal |
| SMILES | CC1(c2cc(Cl)cc(Cl)c2)OC(=S)N(Nc2cccc(CCC=O)c2)C1=O |
| InChI | InChI=1S/C19H16Cl2N2O3S/c1-19(13-9-14(20)11-15(21)10-13)17(25)23(18(27)26-19)22-16-6-2-4-12(8-16)5-3-7-24/h2,4,6-11,22H,3,5H2,1H3 |
| InChIKey | SSEDUMKHPMRIRP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|