C23H38FNO4 — CID 143812396
ethane;2-[6-fluoro-2-(2-methyl-1,3-dioxolan-2-yl)hexyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline (PubChem CID 143812396) has the molecular formula C23H38FNO4 and a molecular weight of 411.56 g/mol. Its IUPAC name is ethane;2-[6-fluoro-2-(2-methyl-1,3-dioxolan-2-yl)hexyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline.
| Compound Name | ethane;2-[6-fluoro-2-(2-methyl-1,3-dioxolan-2-yl)hexyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 143812396 |
| Molecular Formula | C23H38FNO4 |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | ethane;2-[6-fluoro-2-(2-methyl-1,3-dioxolan-2-yl)hexyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline |
| SMILES | CC.COc1cc2c(cc1OC)CN(CC(CCCCF)C1(C)OCCO1)CC2 |
| InChI | InChI=1S/C21H32FNO4.C2H6/c1-21(26-10-11-27-21)18(6-4-5-8-22)15-23-9-7-16-12-19(24-2)20(25-3)13-17(16)14-23;1-2/h12-13,18H,4-11,14-15H2,1-3H3;1-2H3 |
| InChIKey | ICLJYORCHHOBSU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|