C21H24Cl2N2O — CID 143816753
1-(2-chlorophenyl)-5-(4-chlorophenyl)-3-(ethoxymethyl)-4-methylpyrazole;ethane (PubChem CID 143816753) has the molecular formula C21H24Cl2N2O and a molecular weight of 391.34 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-5-(4-chlorophenyl)-3-(ethoxymethyl)-4-methylpyrazole;ethane.
| Compound Name | 1-(2-chlorophenyl)-5-(4-chlorophenyl)-3-(ethoxymethyl)-4-methylpyrazole;ethane |
|---|---|
| PubChem CID | 143816753 |
| Molecular Formula | C21H24Cl2N2O |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1-(2-chlorophenyl)-5-(4-chlorophenyl)-3-(ethoxymethyl)-4-methylpyrazole;ethane |
| SMILES | CC.CCOCc1nn(-c2ccccc2Cl)c(-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C19H18Cl2N2O.C2H6/c1-3-24-12-17-13(2)19(14-8-10-15(20)11-9-14)23(22-17)18-7-5-4-6-16(18)21;1-2/h4-11H,3,12H2,1-2H3;1-2H3 |
| InChIKey | CIGUTJQFKVCKPT-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |