C25H20Cl4N2O — CID 141161184
1-(2-chlorophenyl)-4-methyl-5-(4-phenylmethoxyphenyl)-3-(2,2,2-trichloroethyl)pyrazole (PubChem CID 141161184) has the molecular formula C25H20Cl4N2O and a molecular weight of 506.26 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-4-methyl-5-(4-phenylmethoxyphenyl)-3-(2,2,2-trichloroethyl)pyrazole.
| Compound Name | 1-(2-chlorophenyl)-4-methyl-5-(4-phenylmethoxyphenyl)-3-(2,2,2-trichloroethyl)pyrazole |
|---|---|
| PubChem CID | 141161184 |
| Molecular Formula | C25H20Cl4N2O |
| Molecular Weight | 506.26 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | 1-(2-chlorophenyl)-4-methyl-5-(4-phenylmethoxyphenyl)-3-(2,2,2-trichloroethyl)pyrazole |
| SMILES | Cc1c(CC(Cl)(Cl)Cl)nn(-c2ccccc2Cl)c1-c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H20Cl4N2O/c1-17-22(15-25(27,28)29)30-31(23-10-6-5-9-21(23)26)24(17)19-11-13-20(14-12-19)32-16-18-7-3-2-4-8-18/h2-14H,15-16H2,1H3 |
| InChIKey | VNODDUIOIJSPMP-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.26 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|