C15H24N2 — CID 143818314
ethane;1-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-3-yl]-3-methyl-2H-imidazole (PubChem CID 143818314) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is ethane;1-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-3-yl]-3-methyl-2H-imidazole.
| Compound Name | ethane;1-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-3-yl]-3-methyl-2H-imidazole |
|---|---|
| PubChem CID | 143818314 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | ethane;1-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-3-yl]-3-methyl-2H-imidazole |
| SMILES | C=C/C=C(C=C)\C(=C/C)N1C=CN(C)C1.CC |
| InChI | InChI=1S/C13H18N2.C2H6/c1-5-8-12(6-2)13(7-3)15-10-9-14(4)11-15;1-2/h5-10H,1-2,11H2,3-4H3;1-2H3/b12-8-,13-7+; |
| InChIKey | IWXIMINNJIZGOQ-OFHMLHQCSA-N |
| XLogP | 3.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|