C18H26O — CID 143818930
6-[(3-ethenylphenyl)methyl]nonan-2-one (PubChem CID 143818930) has the molecular formula C18H26O and a molecular weight of 258.41 g/mol. Its IUPAC name is 6-[(3-ethenylphenyl)methyl]nonan-2-one.
| Compound Name | 6-[(3-ethenylphenyl)methyl]nonan-2-one |
|---|---|
| PubChem CID | 143818930 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 6-[(3-ethenylphenyl)methyl]nonan-2-one |
| SMILES | C=Cc1cccc(CC(CCC)CCCC(C)=O)c1 |
| InChI | InChI=1S/C18H26O/c1-4-8-17(11-6-9-15(3)19)14-18-12-7-10-16(5-2)13-18/h5,7,10,12-13,17H,2,4,6,8-9,11,14H2,1,3H3 |
| InChIKey | SJZWHORIRZBZIB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |