C31H40FNO6 — CID 143819281
methyl 2-[(4,4-dimethoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-4-fluoro-5-phenylmethoxybenzoate (PubChem CID 143819281) has the molecular formula C31H40FNO6 and a molecular weight of 541.66 g/mol. Its IUPAC name is methyl 2-[(4,4-dimethoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-4-fluoro-5-phenylmethoxybenzoate.
| Compound Name | methyl 2-[(4,4-dimethoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-4-fluoro-5-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 143819281 |
| Molecular Formula | C31H40FNO6 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | methyl 2-[(4,4-dimethoxycyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-4-fluoro-5-phenylmethoxybenzoate |
| SMILES | COC(=O)c1cc(OCc2ccccc2)c(F)cc1N(C(=O)C1CCC(C)CC1)C1CCC(OC)(OC)CC1 |
| InChI | InChI=1S/C31H40FNO6/c1-21-10-12-23(13-11-21)29(34)33(24-14-16-31(37-3,38-4)17-15-24)27-19-26(32)28(18-25(27)30(35)36-2)39-20-22-8-6-5-7-9-22/h5-9,18-19,21,23-24H,10-17,20H2,1-4H3 |
| InChIKey | JYLYJLUILFZDDK-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|