C31H33F3N3O4S+ — CID 143819608
CID 143819608 (PubChem CID 143819608) has the molecular formula C31H33F3N3O4S+ and a molecular weight of 600.68 g/mol.
| Compound Name | CID 143819608 |
|---|---|
| PubChem CID | 143819608 |
| Molecular Formula | C31H33F3N3O4S+ |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | — |
| SMILES | C[S+](=O)(O)NCc1ccc(-c2cccc(CC(O)(C(=O)Nc3ccc(C#N)c(C(F)(F)F)c3)C3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C31H32F3N3O4S/c1-42(40,41)36-20-21-10-12-23(13-11-21)24-7-5-6-22(16-24)18-30(39,26-8-3-2-4-9-26)29(38)37-27-15-14-25(19-35)28(17-27)31(32,33)34/h5-7,10-17,26,39H,2-4,8-9,18,20H2,1H3,(H2-,36,37,38,40,41)/p+1 |
| InChIKey | XWQXFKZKLWATFG-UHFFFAOYSA-O |
| XLogP | 6.34 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|