C29H31F3N2O3S — CID 89176389
N-[4-amino-3-(trifluoromethyl)phenyl]-2-cyclohexyl-2-hydroxy-3-[3-(4-methylsulfinylphenyl)phenyl]propanamide (PubChem CID 89176389) has the molecular formula C29H31F3N2O3S and a molecular weight of 544.64 g/mol. Its IUPAC name is N-[4-amino-3-(trifluoromethyl)phenyl]-2-cyclohexyl-2-hydroxy-3-[3-(4-methylsulfinylphenyl)phenyl]propanamide.
| Compound Name | N-[4-amino-3-(trifluoromethyl)phenyl]-2-cyclohexyl-2-hydroxy-3-[3-(4-methylsulfinylphenyl)phenyl]propanamide |
|---|---|
| PubChem CID | 89176389 |
| Molecular Formula | C29H31F3N2O3S |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | N-[4-amino-3-(trifluoromethyl)phenyl]-2-cyclohexyl-2-hydroxy-3-[3-(4-methylsulfinylphenyl)phenyl]propanamide |
| SMILES | CS(=O)c1ccc(-c2cccc(CC(O)(C(=O)Nc3ccc(N)c(C(F)(F)F)c3)C3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C29H31F3N2O3S/c1-38(37)24-13-10-20(11-14-24)21-7-5-6-19(16-21)18-28(36,22-8-3-2-4-9-22)27(35)34-23-12-15-26(33)25(17-23)29(30,31)32/h5-7,10-17,22,36H,2-4,8-9,18,33H2,1H3,(H,34,35) |
| InChIKey | GKPCCSSTOCMKBB-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|