C30H41F3N4O2 — CID 89176381
N-[4-amino-3-(trifluoromethyl)phenyl]-2-cyclohexyl-2-hydroxy-3-[3-[(2-piperidin-1-ylethylamino)methyl]phenyl]propanamide (PubChem CID 89176381) has the molecular formula C30H41F3N4O2 and a molecular weight of 546.68 g/mol. Its IUPAC name is N-[4-amino-3-(trifluoromethyl)phenyl]-2-cyclohexyl-2-hydroxy-3-[3-[(2-piperidin-1-ylethylamino)methyl]phenyl]propanamide.
| Compound Name | N-[4-amino-3-(trifluoromethyl)phenyl]-2-cyclohexyl-2-hydroxy-3-[3-[(2-piperidin-1-ylethylamino)methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 89176381 |
| Molecular Formula | C30H41F3N4O2 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | N-[4-amino-3-(trifluoromethyl)phenyl]-2-cyclohexyl-2-hydroxy-3-[3-[(2-piperidin-1-ylethylamino)methyl]phenyl]propanamide |
| SMILES | Nc1ccc(NC(=O)C(O)(Cc2cccc(CNCCN3CCCCC3)c2)C2CCCCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C30H41F3N4O2/c31-30(32,33)26-19-25(12-13-27(26)34)36-28(38)29(39,24-10-3-1-4-11-24)20-22-8-7-9-23(18-22)21-35-14-17-37-15-5-2-6-16-37/h7-9,12-13,18-19,24,35,39H,1-6,10-11,14-17,20-21,34H2,(H,36,38) |
| InChIKey | RPQNYVOHPFETCC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|