C32H34F3N3O3 — CID 89176356
4-[3-[3-[4-amino-3-(trifluoromethyl)anilino]-2-cyclohexyl-2-hydroxy-3-oxopropyl]phenyl]-N-cyclopropylbenzamide (PubChem CID 89176356) has the molecular formula C32H34F3N3O3 and a molecular weight of 565.64 g/mol. Its IUPAC name is 4-[3-[3-[4-amino-3-(trifluoromethyl)anilino]-2-cyclohexyl-2-hydroxy-3-oxopropyl]phenyl]-N-cyclopropylbenzamide.
| Compound Name | 4-[3-[3-[4-amino-3-(trifluoromethyl)anilino]-2-cyclohexyl-2-hydroxy-3-oxopropyl]phenyl]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 89176356 |
| Molecular Formula | C32H34F3N3O3 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 4-[3-[3-[4-amino-3-(trifluoromethyl)anilino]-2-cyclohexyl-2-hydroxy-3-oxopropyl]phenyl]-N-cyclopropylbenzamide |
| SMILES | Nc1ccc(NC(=O)C(O)(Cc2cccc(-c3ccc(C(=O)NC4CC4)cc3)c2)C2CCCCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C32H34F3N3O3/c33-32(34,35)27-18-26(15-16-28(27)36)38-30(40)31(41,24-7-2-1-3-8-24)19-20-5-4-6-23(17-20)21-9-11-22(12-10-21)29(39)37-25-13-14-25/h4-6,9-12,15-18,24-25,41H,1-3,7-8,13-14,19,36H2,(H,37,39)(H,38,40) |
| InChIKey | FOSHGYWCMGXDDM-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|