C33H38F2N2O5 — CID 143819774
N-[4-cyano-3-(1,1-difluoroethyl)phenyl]-2-cyclohexyl-2-hydroxy-3-[3-[2-[(3Z)-4-methoxyhexa-1,3,5-trien-3-yl]oxyethoxy]phenyl]propanamide (PubChem CID 143819774) has the molecular formula C33H38F2N2O5 and a molecular weight of 580.67 g/mol. Its IUPAC name is N-[4-cyano-3-(1,1-difluoroethyl)phenyl]-2-cyclohexyl-2-hydroxy-3-[3-[2-[(3Z)-4-methoxyhexa-1,3,5-trien-3-yl]oxyethoxy]phenyl]propanamide.
| Compound Name | N-[4-cyano-3-(1,1-difluoroethyl)phenyl]-2-cyclohexyl-2-hydroxy-3-[3-[2-[(3Z)-4-methoxyhexa-1,3,5-trien-3-yl]oxyethoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 143819774 |
| Molecular Formula | C33H38F2N2O5 |
| Molecular Weight | 580.67 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | N-[4-cyano-3-(1,1-difluoroethyl)phenyl]-2-cyclohexyl-2-hydroxy-3-[3-[2-[(3Z)-4-methoxyhexa-1,3,5-trien-3-yl]oxyethoxy]phenyl]propanamide |
| SMILES | C=C/C(OC)=C(\C=C)OCCOc1cccc(CC(O)(C(=O)Nc2ccc(C#N)c(C(C)(F)F)c2)C2CCCCC2)c1 |
| InChI | InChI=1S/C33H38F2N2O5/c1-5-29(40-4)30(6-2)42-18-17-41-27-14-10-11-23(19-27)21-33(39,25-12-8-7-9-13-25)31(38)37-26-16-15-24(22-36)28(20-26)32(3,34)35/h5-6,10-11,14-16,19-20,25,39H,1-2,7-9,12-13,17-18,21H2,3-4H3,(H,37,38)/b30-29- |
| InChIKey | PEDSRTQXWSQOQM-FLWNBWAVSA-N |
| XLogP | 6.79 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.67 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|