C18H23F3N2 — CID 143820492
N-[4-[(2S)-5-azabicyclo[2.1.0]pentan-2-yl]cyclohexyl]-4-methyl-3-(trifluoromethyl)aniline (PubChem CID 143820492) has the molecular formula C18H23F3N2 and a molecular weight of 324.39 g/mol. Its IUPAC name is N-[4-[(2S)-5-azabicyclo[2.1.0]pentan-2-yl]cyclohexyl]-4-methyl-3-(trifluoromethyl)aniline.
| Compound Name | N-[4-[(2S)-5-azabicyclo[2.1.0]pentan-2-yl]cyclohexyl]-4-methyl-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 143820492 |
| Molecular Formula | C18H23F3N2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N-[4-[(2S)-5-azabicyclo[2.1.0]pentan-2-yl]cyclohexyl]-4-methyl-3-(trifluoromethyl)aniline |
| SMILES | Cc1ccc(NC2CCC([C@@H]3CC4NC43)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C18H23F3N2/c1-10-2-5-13(8-15(10)18(19,20)21)22-12-6-3-11(4-7-12)14-9-16-17(14)23-16/h2,5,8,11-12,14,16-17,22-23H,3-4,6-7,9H2,1H3/t11?,12?,14-,16?,17?/m0/s1 |
| InChIKey | CWCGUOMDUTXORX-FWDDFMBSSA-N |
| XLogP | 4.34 |
| TPSA | 33.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|