C18H17ClNOP — CID 143823079
(3E)-6-chloro-3-[[3-methyl-4-(methylphosphanylmethyl)phenyl]methylidene]-1H-indol-2-one (PubChem CID 143823079) has the molecular formula C18H17ClNOP and a molecular weight of 329.77 g/mol. Its IUPAC name is (3E)-6-chloro-3-[[3-methyl-4-(methylphosphanylmethyl)phenyl]methylidene]-1H-indol-2-one.
| Compound Name | (3E)-6-chloro-3-[[3-methyl-4-(methylphosphanylmethyl)phenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 143823079 |
| Molecular Formula | C18H17ClNOP |
| Molecular Weight | 329.77 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (3E)-6-chloro-3-[[3-methyl-4-(methylphosphanylmethyl)phenyl]methylidene]-1H-indol-2-one |
| SMILES | CPCc1ccc(/C=C2/C(=O)Nc3cc(Cl)ccc32)cc1C |
| InChI | InChI=1S/C18H17ClNOP/c1-11-7-12(3-4-13(11)10-22-2)8-16-15-6-5-14(19)9-17(15)20-18(16)21/h3-9,22H,10H2,1-2H3,(H,20,21)/b16-8+ |
| InChIKey | ZXYQKFPJDSVHCV-LZYBPNLTSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.77 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|