C19H18NO2P — CID 143823107
(3E)-3-[[3-methyl-4-(methylphosphanylmethyl)phenyl]methylidene]-2-oxo-1H-indole-6-carbaldehyde (PubChem CID 143823107) has the molecular formula C19H18NO2P and a molecular weight of 323.33 g/mol. Its IUPAC name is (3E)-3-[[3-methyl-4-(methylphosphanylmethyl)phenyl]methylidene]-2-oxo-1H-indole-6-carbaldehyde.
| Compound Name | (3E)-3-[[3-methyl-4-(methylphosphanylmethyl)phenyl]methylidene]-2-oxo-1H-indole-6-carbaldehyde |
|---|---|
| PubChem CID | 143823107 |
| Molecular Formula | C19H18NO2P |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (3E)-3-[[3-methyl-4-(methylphosphanylmethyl)phenyl]methylidene]-2-oxo-1H-indole-6-carbaldehyde |
| SMILES | CPCc1ccc(/C=C2/C(=O)Nc3cc(C=O)ccc32)cc1C |
| InChI | InChI=1S/C19H18NO2P/c1-12-7-13(3-5-15(12)11-23-2)8-17-16-6-4-14(10-21)9-18(16)20-19(17)22/h3-10,23H,11H2,1-2H3,(H,20,22)/b17-8+ |
| InChIKey | FWNSXIYAKZJEJL-CAOOACKPSA-N |
| XLogP | 4.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|