C19H20NO2P — CID 59079615
(3Z)-6-(dimethylphosphorylmethyl)-3-[(4-methylphenyl)methylidene]-1H-indol-2-one (PubChem CID 59079615) has the molecular formula C19H20NO2P and a molecular weight of 325.35 g/mol. Its IUPAC name is (3Z)-6-(dimethylphosphorylmethyl)-3-[(4-methylphenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-6-(dimethylphosphorylmethyl)-3-[(4-methylphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 59079615 |
| Molecular Formula | C19H20NO2P |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (3Z)-6-(dimethylphosphorylmethyl)-3-[(4-methylphenyl)methylidene]-1H-indol-2-one |
| SMILES | Cc1ccc(/C=C2\C(=O)Nc3cc(CP(C)(C)=O)ccc32)cc1 |
| InChI | InChI=1S/C19H20NO2P/c1-13-4-6-14(7-5-13)10-17-16-9-8-15(12-23(2,3)22)11-18(16)20-19(17)21/h4-11H,12H2,1-3H3,(H,20,21)/b17-10- |
| InChIKey | AVIQAYQWMZIJPI-YVLHZVERSA-N |
| XLogP | 4.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|