C15H22N2O4 — CID 143825662
ethyl 7-amino-5-propoxy-1H-indole-2-carboxylate;methanol (PubChem CID 143825662) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is ethyl 7-amino-5-propoxy-1H-indole-2-carboxylate;methanol.
| Compound Name | ethyl 7-amino-5-propoxy-1H-indole-2-carboxylate;methanol |
|---|---|
| PubChem CID | 143825662 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | ethyl 7-amino-5-propoxy-1H-indole-2-carboxylate;methanol |
| SMILES | CCCOc1cc(N)c2[nH]c(C(=O)OCC)cc2c1.CO |
| InChI | InChI=1S/C14H18N2O3.CH4O/c1-3-5-19-10-6-9-7-12(14(17)18-4-2)16-13(9)11(15)8-10;1-2/h6-8,16H,3-5,15H2,1-2H3;2H,1H3 |
| InChIKey | JNGDFUKNAHWEKH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 97.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|