C21H26N2O5S — CID 143826045
N-(2-aminophenyl)-2-[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]ethanesulfonamide;formaldehyde (PubChem CID 143826045) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-(2-aminophenyl)-2-[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]ethanesulfonamide;formaldehyde.
| Compound Name | N-(2-aminophenyl)-2-[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]ethanesulfonamide;formaldehyde |
|---|---|
| PubChem CID | 143826045 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-(2-aminophenyl)-2-[4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]ethanesulfonamide;formaldehyde |
| SMILES | C=O.C=O.CC(C)(O)C#Cc1ccc(CCS(=O)(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C19H22N2O3S.2CH2O/c1-19(2,22)13-11-15-7-9-16(10-8-15)12-14-25(23,24)21-18-6-4-3-5-17(18)20;2*1-2/h3-10,21-22H,12,14,20H2,1-2H3;2*1H2 |
| InChIKey | XQAHYYAAVNEXRA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|