C12H12O2 — CID 143829789
(4Z,5E)-4-[(Z)-but-2-enylidene]-5-prop-2-enylidenefuran-3-carbaldehyde (PubChem CID 143829789) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is (4Z,5E)-4-[(Z)-but-2-enylidene]-5-prop-2-enylidenefuran-3-carbaldehyde.
| Compound Name | (4Z,5E)-4-[(Z)-but-2-enylidene]-5-prop-2-enylidenefuran-3-carbaldehyde |
|---|---|
| PubChem CID | 143829789 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (4Z,5E)-4-[(Z)-but-2-enylidene]-5-prop-2-enylidenefuran-3-carbaldehyde |
| SMILES | C=C/C=c1/occ(C=O)/c1=C/C=C\C |
| InChI | InChI=1S/C12H12O2/c1-3-5-7-11-10(8-13)9-14-12(11)6-4-2/h3-9H,2H2,1H3/b5-3-,11-7-,12-6+ |
| InChIKey | QEDIHLLNUQFTER-FVJQXCRCSA-N |
| XLogP | 1.42 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|