C10H12O — CID 123322434
2-but-2-enylidene-4-methyl-3-methylidenefuran (PubChem CID 123322434) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is 2-but-2-enylidene-4-methyl-3-methylidenefuran.
| Compound Name | 2-but-2-enylidene-4-methyl-3-methylidenefuran |
|---|---|
| PubChem CID | 123322434 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 2-but-2-enylidene-4-methyl-3-methylidenefuran |
| SMILES | C=c1c(C)coc1=CC=CC |
| InChI | InChI=1S/C10H12O/c1-4-5-6-10-9(3)8(2)7-11-10/h4-7H,3H2,1-2H3 |
| InChIKey | GWLWGIHOEWXBQK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |